About CID 88660142
CID 88660142 (PubChem CID 88660142) has the molecular formula C11H13N4Se
and a molecular weight of 280.21 g/mol.
Molecular Properties
| Compound Name | CID 88660142 |
| PubChem CID | 88660142 |
| Molecular Formula | C11H13N4Se |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | — |
| SMILES | C=CC/N=C(\[Se])NN=C(C)c1ccccn1 |
| InChI | InChI=1S/C11H13N4Se/c1-3-7-13-11(16)15-14-9(2)10-6-4-5-8-12-10/h3-6,8H,1,7H2,2H3,(H,13,15) |
| InChIKey | ZQYKFHQLQUVIBF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 88660142 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88660142?
The IUPAC name of CID 88660142 (CID 88660142) is not available.
What is the SMILES notation for CID 88660142?
The canonical SMILES for CID 88660142 is C=CC/N=C(\[Se])NN=C(C)c1ccccn1.
What is the InChIKey of CID 88660142?
The InChIKey is ZQYKFHQLQUVIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N4Se/c1-3-7-13-11(16)15-14-9(2)10-6-4-5-8-12-10/h3-6,8H,1,7H2,2H3,(H,13,15).
What are the key properties of CID 88660142?
CID 88660142 has a molecular weight of 280.21 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88660142 is sourced from PubChem (CID 88660142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).