C19H20ClN5O6S — CID 88660255
methyl 3-[[(2Z)-2-[3-[(2-chloroacetyl)amino]-2H-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate (PubChem CID 88660255) has the molecular formula C19H20ClN5O6S and a molecular weight of 481.92 g/mol. Its IUPAC name is methyl 3-[[(2Z)-2-[3-[(2-chloroacetyl)amino]-2H-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl 3-[[(2Z)-2-[3-[(2-chloroacetyl)amino]-2H-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 88660255 |
| Molecular Formula | C19H20ClN5O6S |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | methyl 3-[[(2Z)-2-[3-[(2-chloroacetyl)amino]-2H-1,3-thiazol-4-yl]-2-phenylmethoxyiminoacetyl]amino]-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)C1NC(=O)C1NC(=O)/C(=N\OCc1ccccc1)C1=CSCN1NC(=O)CCl |
| InChI | InChI=1S/C19H20ClN5O6S/c1-30-19(29)16-15(18(28)22-16)21-17(27)14(24-31-8-11-5-3-2-4-6-11)12-9-32-10-25(12)23-13(26)7-20/h2-6,9,15-16H,7-8,10H2,1H3,(H,21,27)(H,22,28)(H,23,26)/b24-14- |
| InChIKey | GTOLPPGRPNCGQP-OYKKKHCWSA-N |
| XLogP | -0.17 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|