C10H18N4S2 — CID 88660718
1-(cyclohexylamino)-6-methyl-1,3,5-triazinane-2,4-dithione (PubChem CID 88660718) has the molecular formula C10H18N4S2 and a molecular weight of 258.42 g/mol. Its IUPAC name is 1-(cyclohexylamino)-6-methyl-1,3,5-triazinane-2,4-dithione.
| Compound Name | 1-(cyclohexylamino)-6-methyl-1,3,5-triazinane-2,4-dithione |
|---|---|
| PubChem CID | 88660718 |
| Molecular Formula | C10H18N4S2 |
| Molecular Weight | 258.42 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(cyclohexylamino)-6-methyl-1,3,5-triazinane-2,4-dithione |
| SMILES | CC1NC(=S)NC(=S)N1NC1CCCCC1 |
| InChI | InChI=1S/C10H18N4S2/c1-7-11-9(15)12-10(16)14(7)13-8-5-3-2-4-6-8/h7-8,13H,2-6H2,1H3,(H2,11,12,15,16) |
| InChIKey | PEYOWCQIBAUSAP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|