C20H22O9 — CID 88661161
(2Z)-3-[1-[(2Z)-2-(carboxymethylidene)pent-4-enoyl]oxy-1-oxohex-4-en-2-yl]oxycarbonylhexa-2,5-dienoic acid (PubChem CID 88661161) has the molecular formula C20H22O9 and a molecular weight of 406.39 g/mol. Its IUPAC name is (2Z)-3-[1-[(2Z)-2-(carboxymethylidene)pent-4-enoyl]oxy-1-oxohex-4-en-2-yl]oxycarbonylhexa-2,5-dienoic acid.
| Compound Name | (2Z)-3-[1-[(2Z)-2-(carboxymethylidene)pent-4-enoyl]oxy-1-oxohex-4-en-2-yl]oxycarbonylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 88661161 |
| Molecular Formula | C20H22O9 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2Z)-3-[1-[(2Z)-2-(carboxymethylidene)pent-4-enoyl]oxy-1-oxohex-4-en-2-yl]oxycarbonylhexa-2,5-dienoic acid |
| SMILES | C=CC/C(=C/C(=O)O)C(=O)OC(=O)C(CC=CC)OC(=O)/C(=C\C(=O)O)CC=C |
| InChI | InChI=1S/C20H22O9/c1-4-7-10-15(28-18(25)13(8-5-2)11-16(21)22)20(27)29-19(26)14(9-6-3)12-17(23)24/h4-7,11-12,15H,2-3,8-10H2,1H3,(H,21,22)(H,23,24)/b7-4?,13-11-,14-12- |
| InChIKey | HBALIZYXDLMZDC-BFBNYBCNSA-N |
| XLogP | 2.11 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|