About azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate
azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate (PubChem CID 88661345) has the molecular formula C13H25N3O3S
and a molecular weight of 303.43 g/mol. Its IUPAC name is azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate.
Molecular Properties
| Compound Name | azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate |
| PubChem CID | 88661345 |
| Molecular Formula | C13H25N3O3S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate |
| SMILES | CNC(=O)O/N=C/C(C)(C)SC.O=C1CCCCCN1 |
| InChI | InChI=1S/C7H14N2O2S.C6H11NO/c1-7(2,12-4)5-9-11-6(10)8-3;8-6-4-2-1-3-5-7-6/h5H,1-4H3,(H,8,10);1-5H2,(H,7,8)/b9-5+; |
| InChIKey | WNDWKSYGDRCSDE-SZKNIZGXSA-N |
| XLogP | 2.15 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate?
The IUPAC name of azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate (CID 88661345) is azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate.
What is the SMILES notation for azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate?
The canonical SMILES for azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate is CNC(=O)O/N=C/C(C)(C)SC.O=C1CCCCCN1.
What is the InChIKey of azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate?
The InChIKey is WNDWKSYGDRCSDE-SZKNIZGXSA-N. The full InChI is InChI=1S/C7H14N2O2S.C6H11NO/c1-7(2,12-4)5-9-11-6(10)8-3;8-6-4-2-1-3-5-7-6/h5H,1-4H3,(H,8,10);1-5H2,(H,7,8)/b9-5+;.
What are the key properties of azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate?
azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate has a molecular weight of 303.43 g/mol, XLogP of 2.15, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-2-one;[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-methylcarbamate is sourced from PubChem (CID 88661345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).