C12H11Cl4NO4S — CID 88661509
methyl (Z)-4-chloro-3-thiophen-2-yl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate (PubChem CID 88661509) has the molecular formula C12H11Cl4NO4S and a molecular weight of 407.10 g/mol. Its IUPAC name is methyl (Z)-4-chloro-3-thiophen-2-yl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate.
| Compound Name | methyl (Z)-4-chloro-3-thiophen-2-yl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate |
|---|---|
| PubChem CID | 88661509 |
| Molecular Formula | C12H11Cl4NO4S |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | methyl (Z)-4-chloro-3-thiophen-2-yl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoate |
| SMILES | COC(=O)C(NC(=O)OCC(Cl)(Cl)Cl)/C(=C/Cl)c1cccs1 |
| InChI | InChI=1S/C12H11Cl4NO4S/c1-20-10(18)9(7(5-13)8-3-2-4-22-8)17-11(19)21-6-12(14,15)16/h2-5,9H,6H2,1H3,(H,17,19)/b7-5+ |
| InChIKey | POQITQYSNDTBPB-FNORWQNLSA-N |
| XLogP | 3.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|