C8H9Cl4NO4 — CID 88661573
(E)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoic acid (PubChem CID 88661573) has the molecular formula C8H9Cl4NO4 and a molecular weight of 324.98 g/mol. Its IUPAC name is (E)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoic acid.
| Compound Name | (E)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoic acid |
|---|---|
| PubChem CID | 88661573 |
| Molecular Formula | C8H9Cl4NO4 |
| Molecular Weight | 324.98 g/mol |
| Exact Mass | 322.93 |
| IUPAC Name | (E)-4-chloro-3-methyl-2-(2,2,2-trichloroethoxycarbonylamino)but-3-enoic acid |
| SMILES | C/C(=C\Cl)C(NC(=O)OCC(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C8H9Cl4NO4/c1-4(2-9)5(6(14)15)13-7(16)17-3-8(10,11)12/h2,5H,3H2,1H3,(H,13,16)(H,14,15)/b4-2+ |
| InChIKey | JDKVJMNSPDKIIP-DUXPYHPUSA-N |
| XLogP | 2.68 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.98 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|