C14H11Cl2F4NO2 — CID 88661930
trans-(2,3,5,6-tetrafluoro-4-pyridinyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88661930) has the molecular formula C14H11Cl2F4NO2 and a molecular weight of 372.15 g/mol. Its IUPAC name is trans-(2,3,5,6-tetrafluoro-4-pyridinyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,3,5,6-tetrafluoro-4-pyridinyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88661930 |
| Molecular Formula | C14H11Cl2F4NO2 |
| Molecular Weight | 372.15 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | trans-(2,3,5,6-tetrafluoro-4-pyridinyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@@H]1C(=O)OCc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C14H11Cl2F4NO2/c1-14(2)6(3-7(15)16)8(14)13(22)23-4-5-9(17)11(19)21-12(20)10(5)18/h3,6,8H,4H2,1-2H3/t6-,8-/m1/s1 |
| InChIKey | AEWMKQAXQGAJGX-HTRCEHHLSA-N |
| XLogP | 4.27 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|