C14H17NO — CID 88662281
7-methoxy-1,2,3,4,10a,10b-hexahydrobenzo[f]quinoline (PubChem CID 88662281) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 7-methoxy-1,2,3,4,10a,10b-hexahydrobenzo[f]quinoline.
| Compound Name | 7-methoxy-1,2,3,4,10a,10b-hexahydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 88662281 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 7-methoxy-1,2,3,4,10a,10b-hexahydrobenzo[f]quinoline |
| SMILES | COC1=CC=CC2C1=CC=C1NCCCC12 |
| InChI | InChI=1S/C14H17NO/c1-16-14-6-2-4-10-11-5-3-9-15-13(11)8-7-12(10)14/h2,4,6-8,10-11,15H,3,5,9H2,1H3 |
| InChIKey | WGRACXKTVBXGEO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |