About 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine
1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine (PubChem CID 88662382) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine.
Molecular Properties
| Compound Name | 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine |
| PubChem CID | 88662382 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine |
| SMILES | C=CCC(C=C)N(N)CC=C |
| InChI | InChI=1S/C9H16N2/c1-4-7-9(6-3)11(10)8-5-2/h4-6,9H,1-3,7-8,10H2 |
| InChIKey | VRTNUSWOXRVHMI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine?
The IUPAC name of 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine (CID 88662382) is 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine.
What is the SMILES notation for 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine?
The canonical SMILES for 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine is C=CCC(C=C)N(N)CC=C.
What is the InChIKey of 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine?
The InChIKey is VRTNUSWOXRVHMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-7-9(6-3)11(10)8-5-2/h4-6,9H,1-3,7-8,10H2.
What are the key properties of 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine?
1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine has a molecular weight of 152.24 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexa-1,5-dien-3-yl-1-prop-2-enylhydrazine is sourced from PubChem (CID 88662382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).