About 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine
1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine (PubChem CID 88663322) has the molecular formula C10H26N4
and a molecular weight of 202.35 g/mol. Its IUPAC name is 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine.
Molecular Properties
| Compound Name | 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine |
| PubChem CID | 88663322 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine |
| SMILES | CCN(CCN(C)C)C(N)C(C)(C)N |
| InChI | InChI=1S/C10H26N4/c1-6-14(8-7-13(4)5)9(11)10(2,3)12/h9H,6-8,11-12H2,1-5H3 |
| InChIKey | PWMMPWRHGUKAGT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine?
The IUPAC name of 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine (CID 88663322) is 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine.
What is the SMILES notation for 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine?
The canonical SMILES for 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine is CCN(CCN(C)C)C(N)C(C)(C)N.
What is the InChIKey of 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine?
The InChIKey is PWMMPWRHGUKAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26N4/c1-6-14(8-7-13(4)5)9(11)10(2,3)12/h9H,6-8,11-12H2,1-5H3.
What are the key properties of 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine?
1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine has a molecular weight of 202.35 g/mol, XLogP of -0.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-[2-(dimethylamino)ethyl]-1-N'-ethyl-2-methylpropane-1,1,2-triamine is sourced from PubChem (CID 88663322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).