C22H30N2O7SSi — CID 88663803
2-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[3-(methylcarbamoyl)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetic acid (PubChem CID 88663803) has the molecular formula C22H30N2O7SSi and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[3-(methylcarbamoyl)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[3-(methylcarbamoyl)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 88663803 |
| Molecular Formula | C22H30N2O7SSi |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 2-[(2R,3S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[3-(methylcarbamoyl)benzoyl]sulfanyl-4-oxoazetidin-1-yl]-2-oxoacetic acid |
| SMILES | CNC(=O)c1cccc(C(=O)S[C@@H]2C(=O)N(C(=O)C(=O)O)[C@@H]2CCO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H30N2O7SSi/c1-22(2,3)33(5,6)31-11-10-15-16(18(26)24(15)19(27)20(28)29)32-21(30)14-9-7-8-13(12-14)17(25)23-4/h7-9,12,15-16H,10-11H2,1-6H3,(H,23,25)(H,28,29)/t15-,16+/m1/s1 |
| InChIKey | HDIMIZWUGDOMAB-CVEARBPZSA-N |
| XLogP | 2.52 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|