C21H30N4S — CID 88663835
3-[(6aR,9S,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylthiourea (PubChem CID 88663835) has the molecular formula C21H30N4S and a molecular weight of 370.57 g/mol. Its IUPAC name is 3-[(6aR,9S,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylthiourea.
| Compound Name | 3-[(6aR,9S,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 88663835 |
| Molecular Formula | C21H30N4S |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 3-[(6aR,9S,10aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)N[C@H]1C[C@@H]2c3cccc4c3c(cn4C)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C21H30N4S/c1-5-25(6-2)21(26)22-15-11-17-16-8-7-9-18-20(16)14(12-23(18)3)10-19(17)24(4)13-15/h7-9,12,15,17,19H,5-6,10-11,13H2,1-4H3,(H,22,26)/t15-,17+,19+/m0/s1 |
| InChIKey | JYYUEASEWCCTHN-KVSKMBFKSA-N |
| XLogP | 3.11 |
| TPSA | 23.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|