C11H13NO3S — CID 88664456
8-methyl-5-sulfonyl-1,2,3,4-tetrahydro-3-benzazepin-9-ol (PubChem CID 88664456) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 8-methyl-5-sulfonyl-1,2,3,4-tetrahydro-3-benzazepin-9-ol.
| Compound Name | 8-methyl-5-sulfonyl-1,2,3,4-tetrahydro-3-benzazepin-9-ol |
|---|---|
| PubChem CID | 88664456 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 8-methyl-5-sulfonyl-1,2,3,4-tetrahydro-3-benzazepin-9-ol |
| SMILES | Cc1ccc2c(c1O)CCNCC2=S(=O)=O |
| InChI | InChI=1S/C11H13NO3S/c1-7-2-3-8-9(11(7)13)4-5-12-6-10(8)16(14)15/h2-3,12-13H,4-6H2,1H3 |
| InChIKey | JRFWOGLHLQEFQU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|