C32H60O6SSi2 — CID 88664868
[(1S,6S,7S,8R)-8-[butyl(dimethyl)silyl]oxy-7-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-methylhept-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate (PubChem CID 88664868) has the molecular formula C32H60O6SSi2 and a molecular weight of 629.07 g/mol. Its IUPAC name is [(1S,6S,7S,8R)-8-[butyl(dimethyl)silyl]oxy-7-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-methylhept-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate.
| Compound Name | [(1S,6S,7S,8R)-8-[butyl(dimethyl)silyl]oxy-7-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-methylhept-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88664868 |
| Molecular Formula | C32H60O6SSi2 |
| Molecular Weight | 629.07 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | [(1S,6S,7S,8R)-8-[butyl(dimethyl)silyl]oxy-7-[(E)-4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-6-methylhept-1-enyl]-3-oxatricyclo[4.3.0.02,4]nonan-4-yl]methyl methanesulfonate |
| SMILES | C=CC(C/C=C/[C@H]1[C@H]2CC3(COS(C)(=O)=O)OC3[C@H]2C[C@H]1O[Si](C)(C)CCCC)(CC(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60O6SSi2/c1-13-15-19-40(9,10)37-28-20-26-27(22-32(29(26)36-32)23-35-39(8,33)34)25(28)17-16-18-31(14-2,21-24(3)4)38-41(11,12)30(5,6)7/h14,16-17,24-29H,2,13,15,18-23H2,1,3-12H3/b17-16+/t25-,26-,27+,28+,29?,31?,32?/m0/s1 |
| InChIKey | ASAJNGNTQJUYMX-JCMWXXLMSA-N |
| XLogP | 8.09 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.07 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|