C10H16O7 — CID 88665056
(5R,6S,7S,8R)-5,6,7,8,9-pentahydroxy-2-methylnon-1-ene-3,4-dione (PubChem CID 88665056) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is (5R,6S,7S,8R)-5,6,7,8,9-pentahydroxy-2-methylnon-1-ene-3,4-dione.
| Compound Name | (5R,6S,7S,8R)-5,6,7,8,9-pentahydroxy-2-methylnon-1-ene-3,4-dione |
|---|---|
| PubChem CID | 88665056 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (5R,6S,7S,8R)-5,6,7,8,9-pentahydroxy-2-methylnon-1-ene-3,4-dione |
| SMILES | C=C(C)C(=O)C(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H16O7/c1-4(2)6(13)8(15)10(17)9(16)7(14)5(12)3-11/h5,7,9-12,14,16-17H,1,3H2,2H3/t5-,7+,9+,10+/m1/s1 |
| InChIKey | QRHNWXNIURNVES-WDYVNVFLSA-N |
| XLogP | -2.86 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|