About butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate
butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate (PubChem CID 88665083) has the molecular formula C10H16O4S
and a molecular weight of 232.30 g/mol. Its IUPAC name is butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate.
Molecular Properties
| Compound Name | butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate |
| PubChem CID | 88665083 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate |
| SMILES | CCCCOS(=O)(=O)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C10H16O4S/c1-2-3-9-14-15(12,13)10(11)7-5-4-6-8-10/h4-7,11H,2-3,8-9H2,1H3 |
| InChIKey | UGXQHQCZGRBQBL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate?
The IUPAC name of butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate (CID 88665083) is butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate.
What is the SMILES notation for butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate?
The canonical SMILES for butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate is CCCCOS(=O)(=O)C1(O)C=CC=CC1.
What is the InChIKey of butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate?
The InChIKey is UGXQHQCZGRBQBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4S/c1-2-3-9-14-15(12,13)10(11)7-5-4-6-8-10/h4-7,11H,2-3,8-9H2,1H3.
What are the key properties of butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate?
butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate has a molecular weight of 232.30 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 1-hydroxycyclohexa-2,4-diene-1-sulfonate is sourced from PubChem (CID 88665083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).