About 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate
3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate (PubChem CID 88665188) has the molecular formula C7H7NO5
and a molecular weight of 185.14 g/mol. Its IUPAC name is 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate |
| PubChem CID | 88665188 |
| Molecular Formula | C7H7NO5 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate |
| SMILES | O=C([O-])C=C[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C7H7NO5/c9-5-1-2-6(10)8(5,13)4-3-7(11)12/h3-4,13H,1-2H2 |
| InChIKey | IINSGORJDHKMAK-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate?
The IUPAC name of 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate (CID 88665188) is 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate.
What is the SMILES notation for 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate?
The canonical SMILES for 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate is O=C([O-])C=C[N+]1(O)C(=O)CCC1=O.
What is the InChIKey of 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate?
The InChIKey is IINSGORJDHKMAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO5/c9-5-1-2-6(10)8(5,13)4-3-7(11)12/h3-4,13H,1-2H2.
What are the key properties of 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate?
3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate has a molecular weight of 185.14 g/mol, XLogP of -1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoate is sourced from PubChem (CID 88665188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).