About 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride
2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride (PubChem CID 88665234) has the molecular formula C8H18Cl2N4
and a molecular weight of 241.17 g/mol. Its IUPAC name is 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride.
Molecular Properties
| Compound Name | 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride |
| PubChem CID | 88665234 |
| Molecular Formula | C8H18Cl2N4 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride |
| SMILES | CC=CC(N)=CCCN=C(N)N.Cl.Cl |
| InChI | InChI=1S/C8H16N4.2ClH/c1-2-4-7(9)5-3-6-12-8(10)11;;/h2,4-5H,3,6,9H2,1H3,(H4,10,11,12);2*1H |
| InChIKey | SATZYIPLCZSRHC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride?
The IUPAC name of 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride (CID 88665234) is 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride.
What is the SMILES notation for 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride?
The canonical SMILES for 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride is CC=CC(N)=CCCN=C(N)N.Cl.Cl.
What is the InChIKey of 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride?
The InChIKey is SATZYIPLCZSRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4.2ClH/c1-2-4-7(9)5-3-6-12-8(10)11;;/h2,4-5H,3,6,9H2,1H3,(H4,10,11,12);2*1H.
What are the key properties of 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride?
2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride has a molecular weight of 241.17 g/mol, XLogP of 0.91, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminohepta-3,5-dienyl)guanidine;dihydrochloride is sourced from PubChem (CID 88665234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).