C6H11FO4S — CID 88665276
(2R,3S,4S)-5-(fluoromethylsulfanyl)-2,3,4-trihydroxypentanal (PubChem CID 88665276) has the molecular formula C6H11FO4S and a molecular weight of 198.21 g/mol. Its IUPAC name is (2R,3S,4S)-5-(fluoromethylsulfanyl)-2,3,4-trihydroxypentanal.
| Compound Name | (2R,3S,4S)-5-(fluoromethylsulfanyl)-2,3,4-trihydroxypentanal |
|---|---|
| PubChem CID | 88665276 |
| Molecular Formula | C6H11FO4S |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | (2R,3S,4S)-5-(fluoromethylsulfanyl)-2,3,4-trihydroxypentanal |
| SMILES | O=C[C@H](O)[C@H](O)[C@H](O)CSCF |
| InChI | InChI=1S/C6H11FO4S/c7-3-12-2-5(10)6(11)4(9)1-8/h1,4-6,9-11H,2-3H2/t4-,5+,6-/m0/s1 |
| InChIKey | HTOMZJOQZCTARW-JKUQZMGJSA-N |
| XLogP | -1.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|