About diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate
diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate (PubChem CID 88666007) has the molecular formula C37H35N3O5
and a molecular weight of 601.70 g/mol. Its IUPAC name is diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate.
Molecular Properties
| Compound Name | diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate |
| PubChem CID | 88666007 |
| Molecular Formula | C37H35N3O5 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC(=O)N(c2ccccc2)c2ccccc2)ccc1Cn1ccc2ccc(N(C(C)=O)C3CCCC3)cc21 |
| InChI | InChI=1S/C37H35N3O5/c1-26(41)39(30-15-9-10-16-30)33-20-19-27-21-22-38(34(27)24-33)25-29-18-17-28(23-35(29)44-2)36(42)45-37(43)40(31-11-5-3-6-12-31)32-13-7-4-8-14-32/h3-8,11-14,17-24,30H,9-10,15-16,25H2,1-2H3 |
| InChIKey | FUUQTDSHYRMZSN-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate?
The IUPAC name of diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate (CID 88666007) is diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate.
What is the SMILES notation for diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate?
The canonical SMILES for diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate is COc1cc(C(=O)OC(=O)N(c2ccccc2)c2ccccc2)ccc1Cn1ccc2ccc(N(C(C)=O)C3CCCC3)cc21.
What is the InChIKey of diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate?
The InChIKey is FUUQTDSHYRMZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H35N3O5/c1-26(41)39(30-15-9-10-16-30)33-20-19-27-21-22-38(34(27)24-33)25-29-18-17-28(23-35(29)44-2)36(42)45-37(43)40(31-11-5-3-6-12-31)32-13-7-4-8-14-32/h3-8,11-14,17-24,30H,9-10,15-16,25H2,1-2H3.
What are the key properties of diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate?
diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate has a molecular weight of 601.70 g/mol, XLogP of 8.11, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylcarbamoyl 4-[[6-[acetyl(cyclopentyl)amino]indol-1-yl]methyl]-3-methoxybenzoate is sourced from PubChem (CID 88666007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).