About 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene
1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene (PubChem CID 88666394) has the molecular formula C18H36PdS2
and a molecular weight of 423.04 g/mol. Its IUPAC name is 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene.
Molecular Properties
| Compound Name | 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene |
| PubChem CID | 88666394 |
| Molecular Formula | C18H36PdS2 |
| Molecular Weight | 423.04 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene |
| SMILES | C=CCSCC=C.CCCCCCSCCCCCC.[Pd] |
| InChI | InChI=1S/C12H26S.C6H10S.Pd/c1-3-5-7-9-11-13-12-10-8-6-4-2;1-3-5-7-6-4-2;/h3-12H2,1-2H3;3-4H,1-2,5-6H2; |
| InChIKey | JUIQUDAEBAMOMK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.04 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene?
The IUPAC name of 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene (CID 88666394) is 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene.
What is the SMILES notation for 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene?
The canonical SMILES for 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene is C=CCSCC=C.CCCCCCSCCCCCC.[Pd].
What is the InChIKey of 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene?
The InChIKey is JUIQUDAEBAMOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26S.C6H10S.Pd/c1-3-5-7-9-11-13-12-10-8-6-4-2;1-3-5-7-6-4-2;/h3-12H2,1-2H3;3-4H,1-2,5-6H2;.
What are the key properties of 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene?
1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene has a molecular weight of 423.04 g/mol, XLogP of 6.97, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexylsulfanylhexane;palladium;3-prop-2-enylsulfanylprop-1-ene is sourced from PubChem (CID 88666394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).