C11H19EuO2- — CID 88666463
europium;2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 88666463) has the molecular formula C11H19EuO2- and a molecular weight of 335.24 g/mol. Its IUPAC name is europium;2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | europium;2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 88666463 |
| Molecular Formula | C11H19EuO2- |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | europium;2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)[CH-]C(=O)C(C)(C)C.[Eu] |
| InChI | InChI=1S/C11H19O2.Eu/c1-10(2,3)8(12)7-9(13)11(4,5)6;/h7H,1-6H3;/q-1; |
| InChIKey | ASLGJFXZLKUNNI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|