C15H16ClF15N2O — CID 88666803
dimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)ethyl]-prop-2-enylazanium chloride (PubChem CID 88666803) has the molecular formula C15H16ClF15N2O and a molecular weight of 560.73 g/mol. Its IUPAC name is dimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)ethyl]-prop-2-enylazanium chloride.
| Compound Name | dimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)ethyl]-prop-2-enylazanium chloride |
|---|---|
| PubChem CID | 88666803 |
| Molecular Formula | C15H16ClF15N2O |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | dimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoylamino)ethyl]-prop-2-enylazanium chloride |
| SMILES | C=CC[N+](C)(C)CCNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C15H15F15N2O.ClH/c1-4-6-32(2,3)7-5-31-8(33)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30;/h4H,1,5-7H2,2-3H3;1H |
| InChIKey | FWOAGAVVCRYWHV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|