C22H26N4O7S — CID 88667184
ethyl 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(benzoylcarbamothioylamino)imidazole-4-carboxylate (PubChem CID 88667184) has the molecular formula C22H26N4O7S and a molecular weight of 490.54 g/mol. Its IUPAC name is ethyl 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(benzoylcarbamothioylamino)imidazole-4-carboxylate.
| Compound Name | ethyl 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(benzoylcarbamothioylamino)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 88667184 |
| Molecular Formula | C22H26N4O7S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | ethyl 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-(benzoylcarbamothioylamino)imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn([C@@H]2O[C@H](CO)[C@H]3OC(C)(C)O[C@H]32)c1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O7S/c1-4-30-20(29)14-17(24-21(34)25-18(28)12-8-6-5-7-9-12)26(11-23-14)19-16-15(13(10-27)31-19)32-22(2,3)33-16/h5-9,11,13,15-16,19,27H,4,10H2,1-3H3,(H2,24,25,28,34)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | PTQDZVWJBUGNFX-NVQRDWNXSA-N |
| XLogP | 1.60 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|