About 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione
5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione (PubChem CID 88667674) has the molecular formula C2H4N2OS3
and a molecular weight of 168.27 g/mol. Its IUPAC name is 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione.
Molecular Properties
| Compound Name | 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione |
| PubChem CID | 88667674 |
| Molecular Formula | C2H4N2OS3 |
| Molecular Weight | 168.27 g/mol |
| Exact Mass | 167.95 |
| IUPAC Name | 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione |
| SMILES | OC1SC(=S)NN1S |
| InChI | InChI=1S/C2H4N2OS3/c5-2-4(7)3-1(6)8-2/h2,5,7H,(H,3,6) |
| InChIKey | KMXHRVVOGMZQMY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione?
The IUPAC name of 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione (CID 88667674) is 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione.
What is the SMILES notation for 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione?
The canonical SMILES for 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione is OC1SC(=S)NN1S.
What is the InChIKey of 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione?
The InChIKey is KMXHRVVOGMZQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N2OS3/c5-2-4(7)3-1(6)8-2/h2,5,7H,(H,3,6).
What are the key properties of 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione?
5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione has a molecular weight of 168.27 g/mol, XLogP of -0.05, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-4-sulfanyl-1,3,4-thiadiazolidine-2-thione is sourced from PubChem (CID 88667674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).