About oxane-2,6-dione;oxolane-2,5-dione
oxane-2,6-dione;oxolane-2,5-dione (PubChem CID 88667859) has the molecular formula C9H10O6
and a molecular weight of 214.17 g/mol. Its IUPAC name is oxane-2,6-dione;oxolane-2,5-dione.
Molecular Properties
| Compound Name | oxane-2,6-dione;oxolane-2,5-dione |
| PubChem CID | 88667859 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | oxane-2,6-dione;oxolane-2,5-dione |
| SMILES | O=C1CCC(=O)O1.O=C1CCCC(=O)O1 |
| InChI | InChI=1S/C5H6O3.C4H4O3/c6-4-2-1-3-5(7)8-4;5-3-1-2-4(6)7-3/h1-3H2;1-2H2 |
| InChIKey | PGLCGWGFQUUTIU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze oxane-2,6-dione;oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxane-2,6-dione;oxolane-2,5-dione?
The IUPAC name of oxane-2,6-dione;oxolane-2,5-dione (CID 88667859) is oxane-2,6-dione;oxolane-2,5-dione.
What is the SMILES notation for oxane-2,6-dione;oxolane-2,5-dione?
The canonical SMILES for oxane-2,6-dione;oxolane-2,5-dione is O=C1CCC(=O)O1.O=C1CCCC(=O)O1.
What is the InChIKey of oxane-2,6-dione;oxolane-2,5-dione?
The InChIKey is PGLCGWGFQUUTIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3.C4H4O3/c6-4-2-1-3-5(7)8-4;5-3-1-2-4(6)7-3/h1-3H2;1-2H2.
What are the key properties of oxane-2,6-dione;oxolane-2,5-dione?
oxane-2,6-dione;oxolane-2,5-dione has a molecular weight of 214.17 g/mol, XLogP of 0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxane-2,6-dione;oxolane-2,5-dione is sourced from PubChem (CID 88667859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).