C17H21F4N5O5S — CID 88667911
(Z)-but-2-enedioic acid;4-[[6-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-2-pyridinyl]sulfanyl]butanamide (PubChem CID 88667911) has the molecular formula C17H21F4N5O5S and a molecular weight of 483.44 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-[[6-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-2-pyridinyl]sulfanyl]butanamide.
| Compound Name | (Z)-but-2-enedioic acid;4-[[6-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-2-pyridinyl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 88667911 |
| Molecular Formula | C17H21F4N5O5S |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[[6-[[N'-(2,2,3,3-tetrafluoropropyl)carbamimidoyl]amino]-2-pyridinyl]sulfanyl]butanamide |
| SMILES | NC(=O)CCCSc1cccc(N/C(N)=N/CC(F)(F)C(F)F)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H17F4N5OS.C4H4O4/c14-11(15)13(16,17)7-20-12(19)22-9-4-1-5-10(21-9)24-6-2-3-8(18)23;5-3(6)1-2-4(7)8/h1,4-5,11H,2-3,6-7H2,(H2,18,23)(H3,19,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | MKKCSRUQVWSKAW-BTJKTKAUSA-N |
| XLogP | 1.78 |
| TPSA | 180.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|