About 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol
1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol (PubChem CID 88669125) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol.
Molecular Properties
| Compound Name | 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol |
| PubChem CID | 88669125 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol |
| SMILES | CC1OC1C1(O)C=CC=C(O)C1 |
| InChI | InChI=1S/C9H12O3/c1-6-8(12-6)9(11)4-2-3-7(10)5-9/h2-4,6,8,10-11H,5H2,1H3 |
| InChIKey | DPEXBLNWUUPEDL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol?
The IUPAC name of 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol (CID 88669125) is 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol.
What is the SMILES notation for 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol?
The canonical SMILES for 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol is CC1OC1C1(O)C=CC=C(O)C1.
What is the InChIKey of 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol?
The InChIKey is DPEXBLNWUUPEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-6-8(12-6)9(11)4-2-3-7(10)5-9/h2-4,6,8,10-11H,5H2,1H3.
What are the key properties of 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol?
1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol has a molecular weight of 168.19 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyloxiran-2-yl)cyclohexa-3,5-diene-1,3-diol is sourced from PubChem (CID 88669125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).