C5H7N5O3S — CID 88669190
1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-sulfonylurea (PubChem CID 88669190) has the molecular formula C5H7N5O3S and a molecular weight of 217.21 g/mol. Its IUPAC name is 1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-sulfonylurea.
| Compound Name | 1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-sulfonylurea |
|---|---|
| PubChem CID | 88669190 |
| Molecular Formula | C5H7N5O3S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 1-(1,5-dimethyl-1,2,4-triazol-3-yl)-3-sulfonylurea |
| SMILES | Cc1nc(NC(=O)N=S(=O)=O)nn1C |
| InChI | InChI=1S/C5H7N5O3S/c1-3-6-4(8-10(3)2)7-5(11)9-14(12)13/h1-2H3,(H,7,8,11) |
| InChIKey | AKZFNIWQMQMLON-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |