About 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea
1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea (PubChem CID 88669613) has the molecular formula C12H12Cl2N2O4S2
and a molecular weight of 383.28 g/mol. Its IUPAC name is 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea.
Molecular Properties
| Compound Name | 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea |
| PubChem CID | 88669613 |
| Molecular Formula | C12H12Cl2N2O4S2 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea |
| SMILES | C=CCSNC(=O)NS(=O)(=O)c1ccccc1O/C(Cl)=C/Cl |
| InChI | InChI=1S/C12H12Cl2N2O4S2/c1-2-7-21-15-12(17)16-22(18,19)10-6-4-3-5-9(10)20-11(14)8-13/h2-6,8H,1,7H2,(H2,15,16,17)/b11-8+ |
| InChIKey | ZILHOEFWQWMENE-DHZHZOJOSA-N |
| XLogP | 3.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea?
The IUPAC name of 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea (CID 88669613) is 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea.
What is the SMILES notation for 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea?
The canonical SMILES for 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea is C=CCSNC(=O)NS(=O)(=O)c1ccccc1O/C(Cl)=C/Cl.
What is the InChIKey of 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea?
The InChIKey is ZILHOEFWQWMENE-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H12Cl2N2O4S2/c1-2-7-21-15-12(17)16-22(18,19)10-6-4-3-5-9(10)20-11(14)8-13/h2-6,8H,1,7H2,(H2,15,16,17)/b11-8+.
What are the key properties of 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea?
1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea has a molecular weight of 383.28 g/mol, XLogP of 3.16, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(Z)-1,2-dichloroethenoxy]phenyl]sulfonyl-3-prop-2-enylsulfanylurea is sourced from PubChem (CID 88669613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).