About bis(dihydroxy(oxo)phosphanium);pentan-1-ol
bis(dihydroxy(oxo)phosphanium);pentan-1-ol (PubChem CID 88669892) has the molecular formula C5H16O7P2+2
and a molecular weight of 250.12 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);pentan-1-ol.
Molecular Properties
| Compound Name | bis(dihydroxy(oxo)phosphanium);pentan-1-ol |
| PubChem CID | 88669892 |
| Molecular Formula | C5H16O7P2+2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);pentan-1-ol |
| SMILES | CCCCCO.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C5H12O.2HO3P/c1-2-3-4-5-6;2*1-4(2)3/h6H,2-5H2,1H3;2*(H-,1,2,3)/p+2 |
| InChIKey | DNSLFJLHHAWABM-UHFFFAOYSA-P |
| XLogP | 0.43 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dihydroxy(oxo)phosphanium);pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihydroxy(oxo)phosphanium);pentan-1-ol?
The IUPAC name of bis(dihydroxy(oxo)phosphanium);pentan-1-ol (CID 88669892) is bis(dihydroxy(oxo)phosphanium);pentan-1-ol.
What is the SMILES notation for bis(dihydroxy(oxo)phosphanium);pentan-1-ol?
The canonical SMILES for bis(dihydroxy(oxo)phosphanium);pentan-1-ol is CCCCCO.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of bis(dihydroxy(oxo)phosphanium);pentan-1-ol?
The InChIKey is DNSLFJLHHAWABM-UHFFFAOYSA-P. The full InChI is InChI=1S/C5H12O.2HO3P/c1-2-3-4-5-6;2*1-4(2)3/h6H,2-5H2,1H3;2*(H-,1,2,3)/p+2.
What are the key properties of bis(dihydroxy(oxo)phosphanium);pentan-1-ol?
bis(dihydroxy(oxo)phosphanium);pentan-1-ol has a molecular weight of 250.12 g/mol, XLogP of 0.43, 3 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxy(oxo)phosphanium);pentan-1-ol is sourced from PubChem (CID 88669892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).