C10H14N2OS — CID 88670625
2-methyl-N-(pyridin-3-ylmethyl)-3-sulfanylpropanamide (PubChem CID 88670625) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-methyl-N-(pyridin-3-ylmethyl)-3-sulfanylpropanamide.
| Compound Name | 2-methyl-N-(pyridin-3-ylmethyl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 88670625 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-methyl-N-(pyridin-3-ylmethyl)-3-sulfanylpropanamide |
| SMILES | CC(CS)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C10H14N2OS/c1-8(7-14)10(13)12-6-9-3-2-4-11-5-9/h2-5,8,14H,6-7H2,1H3,(H,12,13) |
| InChIKey | GYIOXPFHUHULDH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|