About 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one
5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 88670687) has the molecular formula C13H4Cl3F6NO
and a molecular weight of 410.53 g/mol. Its IUPAC name is 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one |
| PubChem CID | 88670687 |
| Molecular Formula | C13H4Cl3F6NO |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(Cl)c(C(F)(F)F)c1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H4Cl3F6NO/c14-5-1-4(12(17,18)19)2-6(15)8(5)9-10(13(20,21)22)7(16)3-23-11(9)24/h1-3H,(H,23,24) |
| InChIKey | BTTOTOLVQIZYMI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
The IUPAC name of 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one (CID 88670687) is 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one.
What is the SMILES notation for 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
The canonical SMILES for 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one is O=c1[nH]cc(Cl)c(C(F)(F)F)c1-c1c(Cl)cc(C(F)(F)F)cc1Cl.
What is the InChIKey of 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
The InChIKey is BTTOTOLVQIZYMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H4Cl3F6NO/c14-5-1-4(12(17,18)19)2-6(15)8(5)9-10(13(20,21)22)7(16)3-23-11(9)24/h1-3H,(H,23,24).
What are the key properties of 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one?
5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one has a molecular weight of 410.53 g/mol, XLogP of 6.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-1H-pyridin-2-one is sourced from PubChem (CID 88670687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).