C34H43BrNO8P — CID 88670732
[(2R)-3-(6-bromohexanoyloxy)-2-(4-pyren-1-ylbutanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 88670732) has the molecular formula C34H43BrNO8P and a molecular weight of 704.59 g/mol. Its IUPAC name is [(2R)-3-(6-bromohexanoyloxy)-2-(4-pyren-1-ylbutanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-(6-bromohexanoyloxy)-2-(4-pyren-1-ylbutanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 88670732 |
| Molecular Formula | C34H43BrNO8P |
| Molecular Weight | 704.59 g/mol |
| Exact Mass | 703.19 |
| IUPAC Name | [(2R)-3-(6-bromohexanoyloxy)-2-(4-pyren-1-ylbutanoyloxy)propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OC[C@@H](COC(=O)CCCCCBr)OC(=O)CCCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C34H43BrNO8P/c1-36(2,3)21-22-42-45(39,40)43-24-29(23-41-31(37)12-5-4-6-20-35)44-32(38)13-8-9-25-14-15-28-17-16-26-10-7-11-27-18-19-30(25)34(28)33(26)27/h7,10-11,14-19,29H,4-6,8-9,12-13,20-24H2,1-3H3/t29-/m1/s1 |
| InChIKey | SPYBFHKCAQIMEG-GDLZYMKVSA-N |
| XLogP | 6.52 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|