C12H18O5 — CID 88670802
2-(1,4,5,6-tetramethoxycyclohexa-2,4-dien-1-yl)acetaldehyde (PubChem CID 88670802) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(1,4,5,6-tetramethoxycyclohexa-2,4-dien-1-yl)acetaldehyde.
| Compound Name | 2-(1,4,5,6-tetramethoxycyclohexa-2,4-dien-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 88670802 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(1,4,5,6-tetramethoxycyclohexa-2,4-dien-1-yl)acetaldehyde |
| SMILES | COC1=C(OC)C(OC)C(CC=O)(OC)C=C1 |
| InChI | InChI=1S/C12H18O5/c1-14-9-5-6-12(17-4,7-8-13)11(16-3)10(9)15-2/h5-6,8,11H,7H2,1-4H3 |
| InChIKey | ZQTGJDUKBRBYAI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|