C20H22FN3O5 — CID 88671062
[1-cyclopropyl-6-fluoro-7-(4-formyl-2,5-dimethylpiperazin-1-yl)-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 88671062) has the molecular formula C20H22FN3O5 and a molecular weight of 403.41 g/mol. Its IUPAC name is [1-cyclopropyl-6-fluoro-7-(4-formyl-2,5-dimethylpiperazin-1-yl)-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [1-cyclopropyl-6-fluoro-7-(4-formyl-2,5-dimethylpiperazin-1-yl)-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88671062 |
| Molecular Formula | C20H22FN3O5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [1-cyclopropyl-6-fluoro-7-(4-formyl-2,5-dimethylpiperazin-1-yl)-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | CC1CN(c2cc3c(cc2F)c(=O)c(OC(=O)O)cn3C2CC2)C(C)CN1C=O |
| InChI | InChI=1S/C20H22FN3O5/c1-11-8-23(12(2)7-22(11)10-25)17-6-16-14(5-15(17)21)19(26)18(29-20(27)28)9-24(16)13-3-4-13/h5-6,9-13H,3-4,7-8H2,1-2H3,(H,27,28) |
| InChIKey | QPBCJVKFFWDKEV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|