About 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene
6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene (PubChem CID 88671076) has the molecular formula C11H16N2O7
and a molecular weight of 288.26 g/mol. Its IUPAC name is 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene |
| PubChem CID | 88671076 |
| Molecular Formula | C11H16N2O7 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene |
| SMILES | COCCOC(C)OC1([N+](=O)[O-])C=C([N+](=O)[O-])C=CC1 |
| InChI | InChI=1S/C11H16N2O7/c1-9(19-7-6-18-2)20-11(13(16)17)5-3-4-10(8-11)12(14)15/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | ZCFRZXIGYXBXRC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene?
The IUPAC name of 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene (CID 88671076) is 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene.
What is the SMILES notation for 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene?
The canonical SMILES for 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene is COCCOC(C)OC1([N+](=O)[O-])C=C([N+](=O)[O-])C=CC1.
What is the InChIKey of 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene?
The InChIKey is ZCFRZXIGYXBXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O7/c1-9(19-7-6-18-2)20-11(13(16)17)5-3-4-10(8-11)12(14)15/h3-4,8-9H,5-7H2,1-2H3.
What are the key properties of 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene?
6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene has a molecular weight of 288.26 g/mol, XLogP of 1.11, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(2-methoxyethoxy)ethoxy]-2,6-dinitrocyclohexa-1,3-diene is sourced from PubChem (CID 88671076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).