About 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform
2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform (PubChem CID 88671202) has the molecular formula C9H11F3NS+
and a molecular weight of 222.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform |
| PubChem CID | 88671202 |
| Molecular Formula | C9H11F3NS+ |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform |
| SMILES | FC(F)F.SC1Cc2cccc[n+]2C1 |
| InChI | InChI=1S/C8H9NS.CHF3/c10-8-5-7-3-1-2-4-9(7)6-8;2-1(3)4/h1-4,8H,5-6H2;1H/p+1 |
| InChIKey | PRKJRPVVOSKKHK-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 3.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform?
The IUPAC name of 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform (CID 88671202) is 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform.
What is the SMILES notation for 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform?
The canonical SMILES for 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform is FC(F)F.SC1Cc2cccc[n+]2C1.
What is the InChIKey of 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform?
The InChIKey is PRKJRPVVOSKKHK-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H9NS.CHF3/c10-8-5-7-3-1-2-4-9(7)6-8;2-1(3)4/h1-4,8H,5-6H2;1H/p+1.
What are the key properties of 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform?
2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform has a molecular weight of 222.26 g/mol, XLogP of 2.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indolizin-4-ium-2-thiol;fluoroform is sourced from PubChem (CID 88671202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).