C13H18F3NO3 — CID 88671422
2,2,2-trifluoro-N-[(2S,3S,4S,6S)-3-hydroxy-2-methyl-6-[(2E)-penta-2,4-dienyl]oxan-4-yl]acetamide (PubChem CID 88671422) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S,3S,4S,6S)-3-hydroxy-2-methyl-6-[(2E)-penta-2,4-dienyl]oxan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S,3S,4S,6S)-3-hydroxy-2-methyl-6-[(2E)-penta-2,4-dienyl]oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 88671422 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S,3S,4S,6S)-3-hydroxy-2-methyl-6-[(2E)-penta-2,4-dienyl]oxan-4-yl]acetamide |
| SMILES | C=C/C=C/C[C@H]1C[C@H](NC(=O)C(F)(F)F)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C13H18F3NO3/c1-3-4-5-6-9-7-10(11(18)8(2)20-9)17-12(19)13(14,15)16/h3-5,8-11,18H,1,6-7H2,2H3,(H,17,19)/b5-4+/t8-,9-,10-,11+/m0/s1 |
| InChIKey | UGXHYNNAUDSALK-LYOZZVMASA-N |
| XLogP | 1.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|