C23H34O6S — CID 88671500
5-hydroxy-2-methylbenzenesulfonic acid;4-pentyl-1-phenylpentane-1,5-diol (PubChem CID 88671500) has the molecular formula C23H34O6S and a molecular weight of 438.59 g/mol. Its IUPAC name is 5-hydroxy-2-methylbenzenesulfonic acid;4-pentyl-1-phenylpentane-1,5-diol.
| Compound Name | 5-hydroxy-2-methylbenzenesulfonic acid;4-pentyl-1-phenylpentane-1,5-diol |
|---|---|
| PubChem CID | 88671500 |
| Molecular Formula | C23H34O6S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 5-hydroxy-2-methylbenzenesulfonic acid;4-pentyl-1-phenylpentane-1,5-diol |
| SMILES | CCCCCC(CO)CCC(O)c1ccccc1.Cc1ccc(O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C16H26O2.C7H8O4S/c1-2-3-5-8-14(13-17)11-12-16(18)15-9-6-4-7-10-15;1-5-2-3-6(8)4-7(5)12(9,10)11/h4,6-7,9-10,14,16-18H,2-3,5,8,11-13H2,1H3;2-4,8H,1H3,(H,9,10,11) |
| InChIKey | LWCHOKWZELZUAQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|