About 2-ethoxyethyl 2-ethoxybutanoate
2-ethoxyethyl 2-ethoxybutanoate (PubChem CID 88671888) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-ethoxyethyl 2-ethoxybutanoate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2-ethoxybutanoate |
| PubChem CID | 88671888 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-ethoxyethyl 2-ethoxybutanoate |
| SMILES | CCOCCOC(=O)C(CC)OCC |
| InChI | InChI=1S/C10H20O4/c1-4-9(13-6-3)10(11)14-8-7-12-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | TUSALZKJAVZCRR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2-ethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2-ethoxybutanoate?
The IUPAC name of 2-ethoxyethyl 2-ethoxybutanoate (CID 88671888) is 2-ethoxyethyl 2-ethoxybutanoate.
What is the SMILES notation for 2-ethoxyethyl 2-ethoxybutanoate?
The canonical SMILES for 2-ethoxyethyl 2-ethoxybutanoate is CCOCCOC(=O)C(CC)OCC.
What is the InChIKey of 2-ethoxyethyl 2-ethoxybutanoate?
The InChIKey is TUSALZKJAVZCRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-4-9(13-6-3)10(11)14-8-7-12-5-2/h9H,4-8H2,1-3H3.
What are the key properties of 2-ethoxyethyl 2-ethoxybutanoate?
2-ethoxyethyl 2-ethoxybutanoate has a molecular weight of 204.27 g/mol, XLogP of 1.38, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2-ethoxybutanoate is sourced from PubChem (CID 88671888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).