C35H36ClFN6O9 — CID 88672811
but-2-enedioic acid;(E)-but-2-enedioic acid;2-chloro-N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]pyridine-3-carboxamide (PubChem CID 88672811) has the molecular formula C35H36ClFN6O9 and a molecular weight of 739.16 g/mol. Its IUPAC name is but-2-enedioic acid;(E)-but-2-enedioic acid;2-chloro-N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | but-2-enedioic acid;(E)-but-2-enedioic acid;2-chloro-N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 88672811 |
| Molecular Formula | C35H36ClFN6O9 |
| Molecular Weight | 739.16 g/mol |
| Exact Mass | 738.22 |
| IUPAC Name | but-2-enedioic acid;(E)-but-2-enedioic acid;2-chloro-N-[2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCN1CCC(Nc2nc3ccccc3n2Cc2ccc(F)cc2)CC1)c1cccnc1Cl.O=C(O)/C=C/C(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C27H28ClFN6O.2C4H4O4/c28-25-22(4-3-13-30-25)26(36)31-14-17-34-15-11-21(12-16-34)32-27-33-23-5-1-2-6-24(23)35(27)18-19-7-9-20(29)10-8-19;2*5-3(6)1-2-4(7)8/h1-10,13,21H,11-12,14-18H2,(H,31,36)(H,32,33);2*1-2H,(H,5,6)(H,7,8)/b;2-1+; |
| InChIKey | ZJQPFQABXVQTTD-JITBQSAISA-N |
| XLogP | 4.00 |
| TPSA | 224.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.16 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|