About methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane
methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane (PubChem CID 88672837) has the molecular formula C12H16Cl3NO2S
and a molecular weight of 344.69 g/mol. Its IUPAC name is methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane.
Molecular Properties
| Compound Name | methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane |
| PubChem CID | 88672837 |
| Molecular Formula | C12H16Cl3NO2S |
| Molecular Weight | 344.69 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane |
| SMILES | CC(Cl)(Cl)Cl.COC(=O)CNSc1ccc(C)cc1 |
| InChI | InChI=1S/C10H13NO2S.C2H3Cl3/c1-8-3-5-9(6-4-8)14-11-7-10(12)13-2;1-2(3,4)5/h3-6,11H,7H2,1-2H3;1H3 |
| InChIKey | OQNPBWOKJOMABJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane?
The IUPAC name of methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane (CID 88672837) is methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane.
What is the SMILES notation for methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane?
The canonical SMILES for methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane is CC(Cl)(Cl)Cl.COC(=O)CNSc1ccc(C)cc1.
What is the InChIKey of methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane?
The InChIKey is OQNPBWOKJOMABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S.C2H3Cl3/c1-8-3-5-9(6-4-8)14-11-7-10(12)13-2;1-2(3,4)5/h3-6,11H,7H2,1-2H3;1H3.
What are the key properties of methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane?
methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane has a molecular weight of 344.69 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-methylphenyl)sulfanylamino]acetate;1,1,1-trichloroethane is sourced from PubChem (CID 88672837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).