About 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene
3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene (PubChem CID 88672895) has the molecular formula C6H6INS
and a molecular weight of 251.09 g/mol. Its IUPAC name is 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene.
Molecular Properties
| Compound Name | 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene |
| PubChem CID | 88672895 |
| Molecular Formula | C6H6INS |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 250.93 |
| IUPAC Name | 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene |
| SMILES | C1=NC2CI=CC=C2S1 |
| InChI | InChI=1S/C6H6INS/c1-2-7-3-5-6(1)9-4-8-5/h1-2,4-5H,3H2 |
| InChIKey | QJYIECPMPGCIAT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene?
The IUPAC name of 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene (CID 88672895) is 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene.
What is the SMILES notation for 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene?
The canonical SMILES for 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene is C1=NC2CI=CC=C2S1.
What is the InChIKey of 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene?
The InChIKey is QJYIECPMPGCIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6INS/c1-2-7-3-5-6(1)9-4-8-5/h1-2,4-5H,3H2.
What are the key properties of 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene?
3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene has a molecular weight of 251.09 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3λ3-ioda-7-thia-9-azabicyclo[4.3.0]nona-3,5,8-triene is sourced from PubChem (CID 88672895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).