C16H28N2O3 — CID 88673078
butyl N-(3-isocyanato-1,3,5,5-tetramethylcyclohexyl)carbamate (PubChem CID 88673078) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is butyl N-(3-isocyanato-1,3,5,5-tetramethylcyclohexyl)carbamate.
| Compound Name | butyl N-(3-isocyanato-1,3,5,5-tetramethylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 88673078 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | butyl N-(3-isocyanato-1,3,5,5-tetramethylcyclohexyl)carbamate |
| SMILES | CCCCOC(=O)NC1(C)CC(C)(C)CC(C)(N=C=O)C1 |
| InChI | InChI=1S/C16H28N2O3/c1-6-7-8-21-13(20)18-16(5)10-14(2,3)9-15(4,11-16)17-12-19/h6-11H2,1-5H3,(H,18,20) |
| InChIKey | DTBHFILWZNVXGH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|