About N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine
N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine (PubChem CID 88673444) has the molecular formula C11H17IN2
and a molecular weight of 304.18 g/mol. Its IUPAC name is N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine |
| PubChem CID | 88673444 |
| Molecular Formula | C11H17IN2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine |
| SMILES | CC1=CC=C(NC2CCNCC2)I=C1 |
| InChI | InChI=1S/C11H17IN2/c1-9-2-3-11(12-8-9)14-10-4-6-13-7-5-10/h2-3,8,10,13-14H,4-7H2,1H3 |
| InChIKey | TYQYWMLNCDARFK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine?
The IUPAC name of N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine (CID 88673444) is N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine.
What is the SMILES notation for N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine?
The canonical SMILES for N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine is CC1=CC=C(NC2CCNCC2)I=C1.
What is the InChIKey of N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine?
The InChIKey is TYQYWMLNCDARFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17IN2/c1-9-2-3-11(12-8-9)14-10-4-6-13-7-5-10/h2-3,8,10,13-14H,4-7H2,1H3.
What are the key properties of N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine?
N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine has a molecular weight of 304.18 g/mol, XLogP of 1.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1λ3-iodacyclohexa-2,4,6-trien-2-yl)piperidin-4-amine is sourced from PubChem (CID 88673444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).