About methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate
methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate (PubChem CID 88673923) has the molecular formula C27H32N2O4
and a molecular weight of 448.56 g/mol. Its IUPAC name is methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate |
| PubChem CID | 88673923 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate |
| SMILES | CCC(N[C@H](O)Cc1ccccc1)(N[C@H](O)Cc1ccccc1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C27H32N2O4/c1-3-27(23-16-14-22(15-17-23)26(32)33-2,28-24(30)18-20-10-6-4-7-11-20)29-25(31)19-21-12-8-5-9-13-21/h4-17,24-25,28-31H,3,18-19H2,1-2H3/t24-,25-/m1/s1 |
| InChIKey | YPQQTISTDBNBNQ-JWQCQUIFSA-N |
| XLogP | 3.34 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate?
The IUPAC name of methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate (CID 88673923) is methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate.
What is the SMILES notation for methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate?
The canonical SMILES for methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate is CCC(N[C@H](O)Cc1ccccc1)(N[C@H](O)Cc1ccccc1)c1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate?
The InChIKey is YPQQTISTDBNBNQ-JWQCQUIFSA-N. The full InChI is InChI=1S/C27H32N2O4/c1-3-27(23-16-14-22(15-17-23)26(32)33-2,28-24(30)18-20-10-6-4-7-11-20)29-25(31)19-21-12-8-5-9-13-21/h4-17,24-25,28-31H,3,18-19H2,1-2H3/t24-,25-/m1/s1.
What are the key properties of methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate?
methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate has a molecular weight of 448.56 g/mol, XLogP of 3.34, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[1,1-bis[[(1R)-1-hydroxy-2-phenylethyl]amino]propyl]benzoate is sourced from PubChem (CID 88673923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).