C18H24I3N3O13 — CID 88674054
5-acetamido-2,4,6-triiodobenzene-1,3-dicarboxylic acid;bis(2,3,4-trihydroxybutanamide) (PubChem CID 88674054) has the molecular formula C18H24I3N3O13 and a molecular weight of 871.11 g/mol. Its IUPAC name is 5-acetamido-2,4,6-triiodobenzene-1,3-dicarboxylic acid;bis(2,3,4-trihydroxybutanamide).
| Compound Name | 5-acetamido-2,4,6-triiodobenzene-1,3-dicarboxylic acid;bis(2,3,4-trihydroxybutanamide) |
|---|---|
| PubChem CID | 88674054 |
| Molecular Formula | C18H24I3N3O13 |
| Molecular Weight | 871.11 g/mol |
| Exact Mass | 870.84 |
| IUPAC Name | 5-acetamido-2,4,6-triiodobenzene-1,3-dicarboxylic acid;bis(2,3,4-trihydroxybutanamide) |
| SMILES | CC(=O)Nc1c(I)c(C(=O)O)c(I)c(C(=O)O)c1I.NC(=O)C(O)C(O)CO.NC(=O)C(O)C(O)CO |
| InChI | InChI=1S/C10H6I3NO5.2C4H9NO4/c1-2(15)14-8-6(12)3(9(16)17)5(11)4(7(8)13)10(18)19;2*5-4(9)3(8)2(7)1-6/h1H3,(H,14,15)(H,16,17)(H,18,19);2*2-3,6-8H,1H2,(H2,5,9) |
| InChIKey | HDJHBOWIZSORMF-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 311.26 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.11 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|