About difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium)
difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) (PubChem CID 88674392) has the molecular formula C24H60F2N6O2S2Si
and a molecular weight of 595.00 g/mol. Its IUPAC name is difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium).
Molecular Properties
| Compound Name | difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) |
| PubChem CID | 88674392 |
| Molecular Formula | C24H60F2N6O2S2Si |
| Molecular Weight | 595.00 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) |
| SMILES | CCN(CC)[S+](N(CC)CC)N(CC)CC.CCN(CC)[S+](N(CC)CC)N(CC)CC.[O-][Si]([O-])(F)F |
| InChI | InChI=1S/2C12H30N3S.F2O2Si/c2*1-7-13(8-2)16(14(9-3)10-4)15(11-5)12-6;1-5(2,3)4/h2*7-12H2,1-6H3;/q2*+1;-2 |
| InChIKey | WJKKHLZOFUTDKX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 595.00 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium)?
The IUPAC name of difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) (CID 88674392) is difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium).
What is the SMILES notation for difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium)?
The canonical SMILES for difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) is CCN(CC)[S+](N(CC)CC)N(CC)CC.CCN(CC)[S+](N(CC)CC)N(CC)CC.[O-][Si]([O-])(F)F.
What is the InChIKey of difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium)?
The InChIKey is WJKKHLZOFUTDKX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H30N3S.F2O2Si/c2*1-7-13(8-2)16(14(9-3)10-4)15(11-5)12-6;1-5(2,3)4/h2*7-12H2,1-6H3;/q2*+1;-2.
What are the key properties of difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium)?
difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) has a molecular weight of 595.00 g/mol, XLogP of 2.83, 18 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(dioxido)silane;bis(tris(diethylamino)sulfanium) is sourced from PubChem (CID 88674392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).